cas: 34101-86-5 — see every product listed under this CAS number, including other names
1,2-Bis(3,4-dimethylphenyl)ethane (CAS 34101-86-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DC6-200mg |
| cas | 34101-86-5 |
| size | 200mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 184.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 1514.00 Pln |
| delivery time | 3 weeks |
|---|
4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethylbenzene (CAS 34101-86-5) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethylbenzene. InChIKey: MOPBWASVAUDDTC-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethylbenzene |
| InChIKey | MOPBWASVAUDDTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CCC2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)