1,2-Bis(4-chlorophenyl)diazene, 95%
cas: 1602-00-2 — see every product listed under this CAS number, including other names
1,2-Bis(4-chlorophenyl)diazene, 95% (CAS 1602-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F335751-100MG |
| cas | 1602-00-2 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1112.13 Pln | |
| Fluorochem | 250mg | 1830.62 Pln | |
| Fluorochem | 1g | 4761.88 Pln | |
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1182.50 Pln | |
| Ambeed | 5g | 3796.88 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2858.00 Pln | |
| Chemat | 5g | 10533.20 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 1269.58 Pln | |
| BLDpharm | 5g | 4085.25 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Bis(4-chlorophenyl)diazene (CAS 1602-00-2) is a chemical compound with the molecular formula C12H8Cl2N2 and a molecular weight of 251.11 g/mol. IUPAC name: bis(4-chlorophenyl)diazene. InChIKey: XHQLXCFUPJSGOE-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | bis(4-chlorophenyl)diazene |
| InChIKey | XHQLXCFUPJSGOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
1,2-Bis(4-chlorophenyl)diazene, Diazene, bis(4-chlorophenyl)-, p,p'-Dichloroazobenzene, Azobenzene, 4,4'-dichloro-, Diazene, 1,2-bis(4-chlorophenyl)-, 2-16-00-00013 (Beilstein Handbook Reference), p,p'Dichloroazobenzene, Azobenzene, 4,4'dichloro, Diazene, bis(4chlorophenyl), Diazene, bis(4-chlorophenyl)-(9CI)