CAS 1049774-59-5 is the registry number for 1,10-Phenanthroline, 2-chloro-, hydrochloride (1:1), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1,10-phenanthroline;hydrochloride (CAS 1049774-59-5) is a chemical compound with the molecular formula C12H8Cl2N2 and a molecular weight of 251.11 g/mol. IUPAC name: 2-chloro-1,10-phenanthroline;hydrochloride. InChIKey: UYRUSASMIPYBLQ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 2-chloro-1,10-phenanthroline;hydrochloride |
| InChIKey | UYRUSASMIPYBLQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C=CC(=N3)Cl)N=C1.Cl |
Computed by PubChem (NCBI)