1,2-Bis(4-methoxyphenyl)-2-oxoethyl cyclohexylcarbamate, 98%
cas: 196599-80-1 — see every product listed under this CAS number, including other names
1,2-Bis(4-methoxyphenyl)-2-oxoethyl cyclohexylcarbamate, 98% (CAS 196599-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1152761-100mg |
| cas | 196599-80-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 2075.60 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 725.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
[1,2-bis(4-methoxyphenyl)-2-oxoethyl] N-cyclohexylcarbamate (CAS 196599-80-1) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: [1,2-bis(4-methoxyphenyl)-2-oxoethyl] N-cyclohexylcarbamate. InChIKey: MTNUOOJIYAKURM-UHFFFAOYSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | [1,2-bis(4-methoxyphenyl)-2-oxoethyl] N-cyclohexylcarbamate |
| InChIKey | MTNUOOJIYAKURM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)OC)OC(=O)NC3CCCCC3 |
Computed by PubChem (NCBI)
Synonyms:
1,2-Bis(4-methoxyphenyl)-2-oxoethyl Cyclohexylcarbamate, [1,2-bis(4-methoxyphenyl)-2-oxoethyl] N-cyclohexylcarbamate, [1,2-bis(4-methoxyphenyl)-2-oxo-ethyl] N-cyclohexylcarbamate, Cyclohexylcarbamic Acid 1,2-Bis(4-methoxyphenyl)-2-oxoethyl Ester, Carbamicacid,N-cyclohexyl-,1,2-bis(4-methoxyphenyl)-2-oxoethylester