CAS 158257-40-0 appears in our catalog under these names: Fmoc-Sta-OH, 98%, Fmoc–statine, Fmoc-(3S,4S)Sta-OH, Fmoc-(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid, Fmoc-Sta-OH 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g, 50g, 500g.
(3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methylheptanoic acid (CAS 158257-40-0) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methylheptanoic acid. InChIKey: JGUYYODGVQXZAY-SFTDATJTSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methylheptanoic acid |
| InChIKey | JGUYYODGVQXZAY-SFTDATJTSA-N |
| SMILES | CC(C)C[C@@H]([C@H](CC(=O)O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)