cas: 433-95-4 — see every product listed under this CAS number, including other names
1,2-Bis(trifluoromethyl)benzene, 98%, 98% (CAS 433-95-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9BG-100g |
| cas | 433-95-4 |
| size | 100g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 5646.80 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 707.60 Pln | |
| Chemat | 25g | 1480.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2-bis(trifluoromethyl)benzene (CAS 433-95-4) is a chemical compound with the molecular formula C8H4F6 and a molecular weight of 214.11 g/mol. IUPAC name: 1,2-bis(trifluoromethyl)benzene. InChIKey: XXZOEDQFGXTEAD-UHFFFAOYSA-N.
| Molecular formula | C8H4F6 |
|---|---|
| Molecular weight | 214.11 g/mol |
| IUPAC name | 1,2-bis(trifluoromethyl)benzene |
| InChIKey | XXZOEDQFGXTEAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)