Products 2396-11-4
CAS 2396-11-4 is the registry number for 1-Fluoro-4-(pentafluoroethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 2396-11-4) is a chemical compound with the molecular formula C8H4F6 and a molecular weight of 214.11 g/mol. IUPAC name: 1-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: DJHARCGVOBGLKI-UHFFFAOYSA-N.
| Molecular formula | C8H4F6 |
|---|---|
| Molecular weight | 214.11 g/mol |
| IUPAC name | 1-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | DJHARCGVOBGLKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)