cas: 73790-20-2 — see every product listed under this CAS number, including other names
1,2-Bis[4-(trifluoromethyl)phenyl]-1,2-ethanedione, 97%, 97% (CAS 73790-20-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116KNF-100mg |
| cas | 73790-20-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 890.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione (CAS 73790-20-2) is a chemical compound with the molecular formula C16H8F6O2 and a molecular weight of 346.22 g/mol. IUPAC name: 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione. InChIKey: WHTKSZOXPDAVMH-UHFFFAOYSA-N.
| Molecular formula | C16H8F6O2 |
|---|---|
| Molecular weight | 346.22 g/mol |
| IUPAC name | 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione |
| InChIKey | WHTKSZOXPDAVMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)