CAS 73790-20-2 appears in our catalog under these names: 1,2-Bis(4-(trifluoromethyl)phenyl)ethane-1,2-dione, 95%, 1,2-Bis[4-(trifluoromethyl)phenyl]-1,2-ethanedione, 97%, 97%, BIS[4-(TRIFLUOROMETHYL)PHENYL]ETHANE-1,2-DIONE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione (CAS 73790-20-2) is a chemical compound with the molecular formula C16H8F6O2 and a molecular weight of 346.22 g/mol. IUPAC name: 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione. InChIKey: WHTKSZOXPDAVMH-UHFFFAOYSA-N.
| Molecular formula | C16H8F6O2 |
|---|---|
| Molecular weight | 346.22 g/mol |
| IUPAC name | 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione |
| InChIKey | WHTKSZOXPDAVMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)