1,2-Dibenzylhydrazine, 95+%
cas: 7626-68-8 — see every product listed under this CAS number, including other names
1,2-Dibenzylhydrazine, 95+% (CAS 7626-68-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A620697-50mg |
| cas | 7626-68-8 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 320.31 Pln | |
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 2055.81 Pln | |
| Ambeed | 5g | 7012.00 Pln | |
| BLDpharm | 50mg | 336.57 Pln | |
| BLDpharm | 100mg | 514.29 Pln | |
| BLDpharm | 250mg | 864.16 Pln | |
| BLDpharm | 1g | 2208.14 Pln | |
| BLDpharm | 5g | 7556.25 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
1,2-dibenzylhydrazine (CAS 7626-68-8) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 1,2-dibenzylhydrazine. InChIKey: GXNVARTZYHDDNN-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 1,2-dibenzylhydrazine |
| InChIKey | GXNVARTZYHDDNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNNCC2=CC=CC=C2 |
Computed by PubChem (NCBI)