cas: 93847-22-4 — see every product listed under this CAS number, including other names
1,2-Dibenzylpyrazolidine-3,5-dione, 95%, 95% (CAS 93847-22-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FT86-100mg |
| cas | 93847-22-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1312.40 Pln | |
| Chemat | 1g | 3438.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,2-dibenzylpyrazolidine-3,5-dione (CAS 93847-22-4) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 1,2-dibenzylpyrazolidine-3,5-dione. InChIKey: JOOQMPBHEPOORK-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 1,2-dibenzylpyrazolidine-3,5-dione |
| InChIKey | JOOQMPBHEPOORK-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(N(C1=O)CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)