CAS 733030-71-2 appears in our catalog under these names: 2-Cyano-3-(2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl)prop-2-enoic acid, (2E)-2-Cyano-3-[2,5-dimethyl-1-(4-methylphenyl)-1h-pyrrol-3-yl]acrylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 10g, 5g, 1g.
(E)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoic acid (CAS 733030-71-2) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: (E)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoic acid. InChIKey: JQDXFUMSLUWYKI-OQLLNIDSSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (E)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoic acid |
| InChIKey | JQDXFUMSLUWYKI-OQLLNIDSSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=C2C)/C=C(\C#N)/C(=O)O)C |
Computed by PubChem (NCBI)