cas: 151276-10-7 — see every product listed under this CAS number, including other names
1,2-Dichloro-4-(trifluoromethoxy)benzene (CAS 151276-10-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629321-1G |
| cas | 151276-10-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4111.07 Pln |
| delivery time | 3-4 weeks |
|---|
1,2-dichloro-4-(trifluoromethoxy)benzene (CAS 151276-10-7) is a chemical compound with the molecular formula C7H3Cl2F3O and a molecular weight of 231.00 g/mol. IUPAC name: 1,2-dichloro-4-(trifluoromethoxy)benzene. InChIKey: SXBGDKFVGXZJDU-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O |
|---|---|
| Molecular weight | 231.00 g/mol |
| IUPAC name | 1,2-dichloro-4-(trifluoromethoxy)benzene |
| InChIKey | SXBGDKFVGXZJDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)