CAS 97608-49-6 appears in our catalog under these names: 1,3-Dichloro-2-(trifluoromethoxy)benzene, 95%, 1,3-Dichloro-2-(trifluoromethoxy)benzene, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg.
1,3-dichloro-2-(trifluoromethoxy)benzene (CAS 97608-49-6) is a chemical compound with the molecular formula C7H3Cl2F3O and a molecular weight of 231.00 g/mol. IUPAC name: 1,3-dichloro-2-(trifluoromethoxy)benzene. InChIKey: RIVHTVHBEUJLSP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O |
|---|---|
| Molecular weight | 231.00 g/mol |
| IUPAC name | 1,3-dichloro-2-(trifluoromethoxy)benzene |
| InChIKey | RIVHTVHBEUJLSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)