cas: 20031-21-4 — see every product listed under this CAS number, including other names
1,2-O-(1-Methylethylidene)-α-D-xylofuranose, 98%, 98% (CAS 20031-21-4) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113COM-1kg |
| cas | 20031-21-4 |
| size | 1kg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 2382.80 Pln | |
| Chemat | 5kg | 10065.60 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 50g | 203.60 Pln | |
| Chemat | 100g | 323.60 Pln | |
| Chemat | 250g | 717.20 Pln | |
| Chemat | 500g | 1440.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3aR,5R,6S,6aR)-5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (CAS 20031-21-4) is a chemical compound with the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. IUPAC name: (3aR,5R,6S,6aR)-5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol. InChIKey: JAUQZVBVVJJRKM-XZBKPIIZSA-N.
| Molecular formula | C8H14O5 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (3aR,5R,6S,6aR)-5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| InChIKey | JAUQZVBVVJJRKM-XZBKPIIZSA-N |
| SMILES | CC1(O[C@@H]2[C@H]([C@H](O[C@@H]2O1)CO)O)C |
Computed by PubChem (NCBI)