Products 84035-77-8
CAS 84035-77-8 appears in our catalog under these names: 3,4-O-Isopropylidene-d-arabinose, 95%, 3,4-O-Isopropylidene-D-arabinose. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg.
(3aR,7S,7aS)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,7-diol (CAS 84035-77-8) is a chemical compound with the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. IUPAC name: (3aR,7S,7aS)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,7-diol. InChIKey: QLLJIUXYLBUIOG-JFRCYRBUSA-N.
| Molecular formula | C8H14O5 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (3aR,7S,7aS)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,7-diol |
| InChIKey | QLLJIUXYLBUIOG-JFRCYRBUSA-N |
| SMILES | CC1(O[C@@H]2COC([C@H]([C@@H]2O1)O)O)C |
Computed by PubChem (NCBI)