1,3,2-Dioxaborolane, 2-[2,2'-bithiophen]-5-yl-4,4,5,5-tetramethyl-, 96%, 96%
cas: 479719-88-5 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 2-[2,2'-bithiophen]-5-yl-4,4,5,5-tetramethyl-, 96%, 96% (CAS 479719-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EON-100mg |
| cas | 479719-88-5 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 918.80 Pln | |
| Chemat | 25g | 2190.80 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(5-thiophen-2-ylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 479719-88-5) is a chemical compound with the molecular formula C14H17BO2S2 and a molecular weight of 292.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5-thiophen-2-ylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: HPOQARMSOPOZMW-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2S2 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5-thiophen-2-ylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | HPOQARMSOPOZMW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=CS3 |
Computed by PubChem (NCBI)
Synonyms:
2,2'-Bithiophene-5-boronic acid pinacol ester, 2-([2,2'-Bithiophen]-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,2'-bithiophene, 4,4,5,5-tetramethyl-2-(5-thiophen-2-ylthiophen-2-yl)-1,3,2-dioxaborolane, 1,3,2-Dioxaborolane, 2-[2,2'-bithiophen]-5-yl-4,4,5,5-tetramethyl-, 2,2-Bithiophene-5-boronic acid pinacol ester, 2,2'-bithiophene-5'-boronic acid pinacol ester, 5-(4,4,5,5-Tetramet, 2,2 inverted exclamation marka-Bithiophene-5-boronic acid pinacol ester, 4,4,5,5-tetramethyl-2-[5-(2-thienyl)-2-thienyl]-1,3,2-dioxaborolane