CAS 479719-88-5 appears in our catalog under these names: 2,2'-BITHIOPHENE-5-BORONIC ACID PINACOL, 2,2′–Bithiophene–5–boronic acid pinacol ester, 2,2'-Bithiophene-5-boronic acid pinacol ester, 96%, 2,2‚Ä≤-Bithiophene-5-boronic acid pinacol ester, 95-<97%, 2,2'-Bithiophene-5-boronic acid pinacol ester, 98% . Offered by: Sigma-Aldrich, GLPBio, Combi-blocks, Hoffman Fine Chemicals, Thermo Scientific (Alfa Aesar). Available pack sizes: 1G, 5g, 25g, 50g, 100g, 200g, 300g, 400g.
4,4,5,5-tetramethyl-2-(5-thiophen-2-ylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 479719-88-5) is a chemical compound with the molecular formula C14H17BO2S2 and a molecular weight of 292.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5-thiophen-2-ylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: HPOQARMSOPOZMW-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2S2 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5-thiophen-2-ylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | HPOQARMSOPOZMW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=CS3 |
Computed by PubChem (NCBI)