cas: 727-49-1 — see every product listed under this CAS number, including other names
1,3,4,5,6,7,8-Heptafluoronaphthalen-2-ol 95+% (CAS 727-49-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277722-100mg |
| cas | 727-49-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1221.44 Pln | |
| Ambeed | 5g | 4597.88 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A277722 |
1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol (CAS 727-49-1) is a chemical compound with the molecular formula C10HF7O and a molecular weight of 270.10 g/mol. IUPAC name: 1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol. InChIKey: RWEQEWKAJFTONV-UHFFFAOYSA-N.
| Molecular formula | C10HF7O |
|---|---|
| Molecular weight | 270.10 g/mol |
| IUPAC name | 1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol |
| InChIKey | RWEQEWKAJFTONV-UHFFFAOYSA-N |
| SMILES | C12=C(C(=C(C(=C1F)O)F)F)C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)