cas: 844891-04-9 — see every product listed under this CAS number, including other names
1,3,5-Trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 95% (CAS 844891-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192122-250mg |
| cas | 844891-04-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1304.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A192122 |
1,3,5-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 844891-04-9) is a chemical compound with the molecular formula C12H21BN2O2 and a molecular weight of 236.12 g/mol. IUPAC name: 1,3,5-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: IZNGYNMIIVJWSO-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O2 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 1,3,5-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | IZNGYNMIIVJWSO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2C)C)C |
Computed by PubChem (NCBI)