CAS 1983152-92-6 appears in our catalog under these names: 3-Isopropylpyrazole-4-boronic acid pinacol ester, 95%, 3-Isopropyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CAS 1983152-92-6) is a chemical compound with the molecular formula C12H21BN2O2 and a molecular weight of 236.12 g/mol. IUPAC name: 5-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole. InChIKey: CCSAOVXHBKZRHL-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O2 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 5-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| InChIKey | CCSAOVXHBKZRHL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(NN=C2)C(C)C |
Computed by PubChem (NCBI)