cas: 26850-24-8 — see every product listed under this CAS number, including other names
1,3-Bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione 97% (CAS 26850-24-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A372366-5g |
| cas | 26850-24-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 776.44 Pln | |
| Ambeed | 100g | 2756.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A372366 |
1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione (CAS 26850-24-8) is a chemical compound with the molecular formula C9H16N2O4 and a molecular weight of 216.23 g/mol. IUPAC name: 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione. InChIKey: ATIAIEWDRRJGSL-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O4 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione |
| InChIKey | ATIAIEWDRRJGSL-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1CCO)CCO)C |
Computed by PubChem (NCBI)