cas: 26850-24-8 — see every product listed under this CAS number, including other names
1,3-Bis(2-hydroxyethyl)-5,5-dimethylhydantoin, 98%, 98% (CAS 26850-24-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DQ2Y-10g |
| cas | 26850-24-8 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 304.40 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 25g | 534.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione (CAS 26850-24-8) is a chemical compound with the molecular formula C9H16N2O4 and a molecular weight of 216.23 g/mol. IUPAC name: 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione. InChIKey: ATIAIEWDRRJGSL-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O4 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione |
| InChIKey | ATIAIEWDRRJGSL-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1CCO)CCO)C |
Computed by PubChem (NCBI)