Products 141556-46-9

CAS 141556-46-9 appears in our catalog under these names: 1,3-Bis(4-chlorophenyl)-1H-imidazol-3-ium chloride, 97%, 97%, 1,3-Bis(4-chlorophenyl)-1H-imidazol-3-ium chloride, 97%, 1H-Imidazolium, 1,3-bis(4-chlorophenyl)-, chloride (1:1), 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.

Structural formula: {0} (CAS {1})

1,3-bis(4-chlorophenyl)imidazol-1-ium chloride (CAS 141556-46-9) is a chemical compound with the molecular formula C15H11Cl3N2 and a molecular weight of 325.6 g/mol. IUPAC name: 1,3-bis(4-chlorophenyl)imidazol-1-ium chloride. InChIKey: SANZEZUASUDVTC-UHFFFAOYSA-M.

Identity
Molecular formulaC15H11Cl3N2
Molecular weight325.6 g/mol
IUPAC name1,3-bis(4-chlorophenyl)imidazol-1-ium chloride
InChIKeySANZEZUASUDVTC-UHFFFAOYSA-M
SMILESC1=CC(=CC=C1N2C=C[N+](=C2)C3=CC=C(C=C3)Cl)Cl.[Cl-]

Computed by PubChem (NCBI)