CAS 1967768-31-5 is the registry number for 2,2'-((2,4,6-Trichlorophenyl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1H-pyrrol-2-yl-(2,4,6-trichlorophenyl)methyl]-1H-pyrrole (CAS 1967768-31-5) is a chemical compound with the molecular formula C15H11Cl3N2 and a molecular weight of 325.6 g/mol. IUPAC name: 2-[1H-pyrrol-2-yl-(2,4,6-trichlorophenyl)methyl]-1H-pyrrole. InChIKey: PMLXZLVEDBRCQF-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl3N2 |
|---|---|
| Molecular weight | 325.6 g/mol |
| IUPAC name | 2-[1H-pyrrol-2-yl-(2,4,6-trichlorophenyl)methyl]-1H-pyrrole |
| InChIKey | PMLXZLVEDBRCQF-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(C2=CC=CN2)C3=C(C=C(C=C3Cl)Cl)Cl |
Computed by PubChem (NCBI)