cas: 710-94-1 — see every product listed under this CAS number, including other names
1,3-Diazaspiro(4.7)dodecane-2,4-dione, 97% (CAS 710-94-1) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A413665-5g |
| cas | 710-94-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7074.76 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-diazaspiro[4.7]dodecane-2,4-dione (CAS 710-94-1) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: 1,3-diazaspiro[4.7]dodecane-2,4-dione. InChIKey: NMKBJKPVCZJVTI-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 1,3-diazaspiro[4.7]dodecane-2,4-dione |
| InChIKey | NMKBJKPVCZJVTI-UHFFFAOYSA-N |
| SMILES | C1CCCC2(CCC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)