Products 61827-59-6
CAS 61827-59-6 is the registry number for 1,3-Dibromo-4-methoxy-2-methyl-5-nitrobenzene, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dibromo-4-methoxy-2-methyl-5-nitrobenzene (CAS 61827-59-6) is a chemical compound with the molecular formula C8H7Br2NO3 and a molecular weight of 324.95 g/mol. IUPAC name: 1,3-dibromo-4-methoxy-2-methyl-5-nitrobenzene. InChIKey: KLZMIPVNKVRDIX-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO3 |
|---|---|
| Molecular weight | 324.95 g/mol |
| IUPAC name | 1,3-dibromo-4-methoxy-2-methyl-5-nitrobenzene |
| InChIKey | KLZMIPVNKVRDIX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Br)OC)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)