CAS 17194-81-9 is the registry number for Dienone B, 97.15%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 50 mg, 5 mg.
2-(3,5-dibromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide (CAS 17194-81-9) is a chemical compound with the molecular formula C8H7Br2NO3 and a molecular weight of 324.95 g/mol. IUPAC name: 2-(3,5-dibromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide. InChIKey: OPJJYFWUWHEWDE-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO3 |
|---|---|
| Molecular weight | 324.95 g/mol |
| IUPAC name | 2-(3,5-dibromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide |
| InChIKey | OPJJYFWUWHEWDE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=CC1(CC(=O)N)O)Br)Br |
Computed by PubChem (NCBI)