Products 17194-81-9

CAS 17194-81-9 is the registry number for Dienone B, 97.15%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 50 mg, 5 mg.

Structural formula: {0} (CAS {1})

2-(3,5-dibromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide (CAS 17194-81-9) is a chemical compound with the molecular formula C8H7Br2NO3 and a molecular weight of 324.95 g/mol. IUPAC name: 2-(3,5-dibromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide. InChIKey: OPJJYFWUWHEWDE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7Br2NO3
Molecular weight324.95 g/mol
IUPAC name2-(3,5-dibromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetamide
InChIKeyOPJJYFWUWHEWDE-UHFFFAOYSA-N
SMILESC1=C(C(=O)C(=CC1(CC(=O)N)O)Br)Br

Computed by PubChem (NCBI)