cas: 1824388-07-9 — see every product listed under this CAS number, including other names
1,3-Dibromo-5-chloro-2-nitrobenzene 97% (CAS 1824388-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A724220-100mg |
| cas | 1824388-07-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 414.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A724220 |
1,3-dibromo-5-chloro-2-nitrobenzene (CAS 1824388-07-9) is a chemical compound with the molecular formula C6H2Br2ClNO2 and a molecular weight of 315.34 g/mol. IUPAC name: 1,3-dibromo-5-chloro-2-nitrobenzene. InChIKey: QQGVCPVDRUOKNK-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2ClNO2 |
|---|---|
| Molecular weight | 315.34 g/mol |
| IUPAC name | 1,3-dibromo-5-chloro-2-nitrobenzene |
| InChIKey | QQGVCPVDRUOKNK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)