cas: 1824388-07-9 — see every product listed under this CAS number, including other names
4-Chloro-2,6-dibromonitrobenzene, 97%, 97% (CAS 1824388-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2DS-100mg |
| cas | 1824388-07-9 |
| size | 100mg |
| availability | 0.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromo-5-chloro-2-nitrobenzene (CAS 1824388-07-9) is a chemical compound with the molecular formula C6H2Br2ClNO2 and a molecular weight of 315.34 g/mol. IUPAC name: 1,3-dibromo-5-chloro-2-nitrobenzene. InChIKey: QQGVCPVDRUOKNK-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2ClNO2 |
|---|---|
| Molecular weight | 315.34 g/mol |
| IUPAC name | 1,3-dibromo-5-chloro-2-nitrobenzene |
| InChIKey | QQGVCPVDRUOKNK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)