Products 202656-23-3
CAS 202656-23-3 appears in our catalog under these names: 1,3-Dichloropropene-d4, 1,3-Dichloropropene-d4 (cis/trans mixture), 98 atom % D, min 98% Chemical Purity, D4-1,3-Dichloropropene (cis/trans mixture). Offered by: Chemat Brand, CDN, HPC Standards. Available pack sizes: on request, 0,05g, 1x10mg.
(E)-1,3-dichloro-1,2,3,3-tetradeuterioprop-1-ene (CAS 202656-23-3) is a chemical compound with the molecular formula C3H4Cl2 and a molecular weight of 114.99 g/mol. IUPAC name: (E)-1,3-dichloro-1,2,3,3-tetradeuterioprop-1-ene. InChIKey: UOORRWUZONOOLO-PAANGKQJSA-N.
| Molecular formula | C3H4Cl2 |
|---|---|
| Molecular weight | 114.99 g/mol |
| IUPAC name | (E)-1,3-dichloro-1,2,3,3-tetradeuterioprop-1-ene |
| InChIKey | UOORRWUZONOOLO-PAANGKQJSA-N |
| SMILES | [2H]/C(=C(/[2H])\Cl)/C([2H])([2H])Cl |
Computed by PubChem (NCBI)