cas: 286014-38-8 — see every product listed under this CAS number, including other names
1,3-Dicyclohexyl-1H-imidazol-3-ium tetrafluoroborate, 98% (CAS 286014-38-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F324267-100G |
| cas | 286014-38-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 5454.35 Pln | |
| Fluorochem | 100mg | 81.24 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 758.08 Pln | |
| Fluorochem | 25g | 1794.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,3-dicyclohexylimidazol-1-ium tetrafluoroborate (CAS 286014-38-8) is a chemical compound with the molecular formula C15H25BF4N2 and a molecular weight of 320.18 g/mol. IUPAC name: 1,3-dicyclohexylimidazol-1-ium tetrafluoroborate. InChIKey: CQHXJIHJFMBBQA-UHFFFAOYSA-N.
| Molecular formula | C15H25BF4N2 |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | 1,3-dicyclohexylimidazol-1-ium tetrafluoroborate |
| InChIKey | CQHXJIHJFMBBQA-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1CCC(CC1)N2C=C[N+](=C2)C3CCCCC3 |
Computed by PubChem (NCBI)