cas: 286014-38-8 — see every product listed under this CAS number, including other names
1,3-Dicyclohexylimidazolium Tetrafluoroborate, >98.0%(HPLC)(N) (CAS 286014-38-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3850-1G |
| cas | 286014-38-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 375.53 Pln | |
| TCI | 5g | 960.68 Pln | |
| TCI | 25g | 2829.24 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
1,3-dicyclohexylimidazol-1-ium tetrafluoroborate (CAS 286014-38-8) is a chemical compound with the molecular formula C15H25BF4N2 and a molecular weight of 320.18 g/mol. IUPAC name: 1,3-dicyclohexylimidazol-1-ium tetrafluoroborate. InChIKey: CQHXJIHJFMBBQA-UHFFFAOYSA-N.
| Molecular formula | C15H25BF4N2 |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | 1,3-dicyclohexylimidazol-1-ium tetrafluoroborate |
| InChIKey | CQHXJIHJFMBBQA-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1CCC(CC1)N2C=C[N+](=C2)C3CCCCC3 |
Computed by PubChem (NCBI)