1,3-Difluoro-2-(4-iodophenoxy)benzene, 95%
cas: 1414356-26-5 — see every product listed under this CAS number, including other names
1,3-Difluoro-2-(4-iodophenoxy)benzene, 95% (CAS 1414356-26-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A665491-100mg |
| cas | 1414356-26-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 887.69 Pln | |
| Ambeed | 1g | 1699.81 Pln | |
| BLDpharm | 100mg | 558.72 Pln | |
| BLDpharm | 250mg | 947.47 Pln | |
| BLDpharm | 1g | 1824.94 Pln | |
| BLDpharm | 5g | 5340.37 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 1058.00 Pln | |
| Chemat | 5g | 4077.20 Pln | |
| Fluorochem | 1g | 1955.58 Pln | |
| Fluorochem | 5g | 7422.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,3-difluoro-2-(4-iodophenoxy)benzene (CAS 1414356-26-5) is a chemical compound with the molecular formula C12H7F2IO and a molecular weight of 332.08 g/mol. IUPAC name: 1,3-difluoro-2-(4-iodophenoxy)benzene. InChIKey: CKZOAYQFIUHRPK-UHFFFAOYSA-N.
| Molecular formula | C12H7F2IO |
|---|---|
| Molecular weight | 332.08 g/mol |
| IUPAC name | 1,3-difluoro-2-(4-iodophenoxy)benzene |
| InChIKey | CKZOAYQFIUHRPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC2=CC=C(C=C2)I)F |
Computed by PubChem (NCBI)