CAS 851199-61-6 is the registry number for 2,4-Difluoro-1-(4-iodophenoxy)benzene, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,4-difluoro-1-(4-iodophenoxy)benzene (CAS 851199-61-6) is a chemical compound with the molecular formula C12H7F2IO and a molecular weight of 332.08 g/mol. IUPAC name: 2,4-difluoro-1-(4-iodophenoxy)benzene. InChIKey: CAFFKFQNIHVCRG-UHFFFAOYSA-N.
| Molecular formula | C12H7F2IO |
|---|---|
| Molecular weight | 332.08 g/mol |
| IUPAC name | 2,4-difluoro-1-(4-iodophenoxy)benzene |
| InChIKey | CAFFKFQNIHVCRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)F)F)I |
Computed by PubChem (NCBI)