cas: 171421-55-9 — see every product listed under this CAS number, including other names
1,3-Difluoro-5-(methylsulfonyl)benzene (CAS 171421-55-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210163-1G |
| cas | 171421-55-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1382.86 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-difluoro-5-methylsulfonylbenzene (CAS 171421-55-9) is a chemical compound with the molecular formula C7H6F2O2S and a molecular weight of 192.19 g/mol. IUPAC name: 1,3-difluoro-5-methylsulfonylbenzene. InChIKey: FEVDSYDQNXTMPT-UHFFFAOYSA-N.
| Molecular formula | C7H6F2O2S |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 1,3-difluoro-5-methylsulfonylbenzene |
| InChIKey | FEVDSYDQNXTMPT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)