CAS 171421-55-9 appears in our catalog under these names: 1,3-Difluoro-5-methylsulfonylbenzene, 98%, 1,3-Difluoro-5-(methylsulfonyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
1,3-difluoro-5-methylsulfonylbenzene (CAS 171421-55-9) is a chemical compound with the molecular formula C7H6F2O2S and a molecular weight of 192.19 g/mol. IUPAC name: 1,3-difluoro-5-methylsulfonylbenzene. InChIKey: FEVDSYDQNXTMPT-UHFFFAOYSA-N.
| Molecular formula | C7H6F2O2S |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 1,3-difluoro-5-methylsulfonylbenzene |
| InChIKey | FEVDSYDQNXTMPT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)