1,3-Dimesityl-1H-imidazol-3-ium chloride, 98%
cas: 141556-45-8 — see every product listed under this CAS number, including other names
1,3-Dimesityl-1H-imidazol-3-ium chloride, 98% (CAS 141556-45-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 1kg, 250mg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch112GKR-1g |
| cas | 141556-45-8 |
| size | 1g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 50g | 486.80 Pln | |
| Chemat | 100g | 722.00 Pln | |
| Chemat | 1kg | 6026.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 219.95 Pln | |
| BLDpharm | 10g | 275.48 Pln | |
| BLDpharm | 25g | 536.50 Pln | |
| BLDpharm | 100g | 1352.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride (CAS 141556-45-8) is a chemical compound with the molecular formula C21H25ClN2 and a molecular weight of 340.9 g/mol. IUPAC name: 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride. InChIKey: OTOSIXGMLYKKOW-UHFFFAOYSA-M.
| Molecular formula | C21H25ClN2 |
|---|---|
| Molecular weight | 340.9 g/mol |
| IUPAC name | 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride |
| InChIKey | OTOSIXGMLYKKOW-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
1,3-Bis(2,4,6-trimethylphenyl)imidazolium chloride, 1,3-Dimesityl-1H-imidazol-3-ium chloride, 1,3-Dimesitylimidazolium Chloride, IMes.HCl, 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium;chloride, 1,3-Dimesitylimidazolium (chloride), 1,3-Bis(2,4,6-trimethylphenyl)imidazoliumchloride, 1,3-Dimesitylimidazoliumchloride, 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium, orb2939269