CAS 141556-45-8 appears in our catalog under these names: 1,3-Dimesitylimidazolium Chloride, 1,3–Bis(2,4,6–trimethylphenyl)imidazolium chloride, 1,3-Dimesitylimidazolium Chloride, >98.0%(HPLC), 1,3-Bis(2,4,6-trimethylphenyl)imidazolium chloride, 95%, IMes.HCl 98%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 2,5g, 500mg, 10g, 5g, 25g, 100g, 50g.
1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride (CAS 141556-45-8) is a chemical compound with the molecular formula C21H25ClN2 and a molecular weight of 340.9 g/mol. IUPAC name: 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride. InChIKey: OTOSIXGMLYKKOW-UHFFFAOYSA-M.
| Molecular formula | C21H25ClN2 |
|---|---|
| Molecular weight | 340.9 g/mol |
| IUPAC name | 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium chloride |
| InChIKey | OTOSIXGMLYKKOW-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)