CAS 286014-53-7 appears in our catalog under these names: 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate, 98%, 98%, 1,3-Bis(2,4,6-trimethylphenyl)imidazolium tetrafluoroborate, 98%, 1,3-Dimesityl-1H-imidazol-3-ium tetrafluoroborate, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g.
1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium tetrafluoroborate (CAS 286014-53-7) is a chemical compound with the molecular formula C21H25BF4N2 and a molecular weight of 392.2 g/mol. IUPAC name: 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium tetrafluoroborate. InChIKey: VMNIOVNFFKZSAL-UHFFFAOYSA-N.
| Molecular formula | C21H25BF4N2 |
|---|---|
| Molecular weight | 392.2 g/mol |
| IUPAC name | 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium tetrafluoroborate |
| InChIKey | VMNIOVNFFKZSAL-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C |
Computed by PubChem (NCBI)