CAS 2757082-93-0 appears in our catalog under these names: 1,3-Bis((R)-1-phenylpropyl)-1H-imidazol-3-ium tetrafluoroborate, 97%, 97%, 1,3-Bis((R)-1-phenylpropyl)-1H-imidazol-3-ium tetrafluoroborate, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1,3-bis[(1R)-1-phenylpropyl]imidazol-1-ium tetrafluoroborate (CAS 2757082-93-0) is a chemical compound with the molecular formula C21H25BF4N2 and a molecular weight of 392.2 g/mol. IUPAC name: 1,3-bis[(1R)-1-phenylpropyl]imidazol-1-ium tetrafluoroborate. InChIKey: AWZLGNRFCOAYEN-MUCZFFFMSA-N.
| Molecular formula | C21H25BF4N2 |
|---|---|
| Molecular weight | 392.2 g/mol |
| IUPAC name | 1,3-bis[(1R)-1-phenylpropyl]imidazol-1-ium tetrafluoroborate |
| InChIKey | AWZLGNRFCOAYEN-MUCZFFFMSA-N |
| SMILES | [B-](F)(F)(F)F.CC[C@H](C1=CC=CC=C1)N2C=C[N+](=C2)[C@H](CC)C3=CC=CC=C3 |
Computed by PubChem (NCBI)