cas: 1806452-66-3 — see every product listed under this CAS number, including other names
1,3-Dimethoxy-5-fluoro-2-nitrobenzene 95+% (CAS 1806452-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A612481-100mg |
| cas | 1806452-66-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 743.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A612481 |
5-fluoro-1,3-dimethoxy-2-nitrobenzene (CAS 1806452-66-3) is a chemical compound with the molecular formula C8H8FNO4 and a molecular weight of 201.15 g/mol. IUPAC name: 5-fluoro-1,3-dimethoxy-2-nitrobenzene. InChIKey: GISWQRJBYQDLCM-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 5-fluoro-1,3-dimethoxy-2-nitrobenzene |
| InChIKey | GISWQRJBYQDLCM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1[N+](=O)[O-])OC)F |
Computed by PubChem (NCBI)