CAS 195136-62-0 is the registry number for 2,4-Dimethoxy-5-fluoronitrobenzene. Offered by: Biosynth. Available pack sizes: 2,5g.
1-fluoro-2,4-dimethoxy-5-nitrobenzene (CAS 195136-62-0) is a chemical compound with the molecular formula C8H8FNO4 and a molecular weight of 201.15 g/mol. IUPAC name: 1-fluoro-2,4-dimethoxy-5-nitrobenzene. InChIKey: KADJLLXINJRFKF-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 1-fluoro-2,4-dimethoxy-5-nitrobenzene |
| InChIKey | KADJLLXINJRFKF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1[N+](=O)[O-])F)OC |
Computed by PubChem (NCBI)