cas: 1235439-97-0 — see every product listed under this CAS number, including other names
1,3-Dimethyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonyl chloride, 97% (CAS 1235439-97-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A194780-5g |
| cas | 1235439-97-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 20127.31 Pln | |
| AmBeed | 10g | 28167.16 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride (CAS 1235439-97-0) is a chemical compound with the molecular formula C8H8ClN3O2S and a molecular weight of 245.69 g/mol. IUPAC name: 1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride. InChIKey: MOLOPKIPWIMCPZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2S |
|---|---|
| Molecular weight | 245.69 g/mol |
| IUPAC name | 1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride |
| InChIKey | MOLOPKIPWIMCPZ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)