CAS 1235439-97-0 appears in our catalog under these names: 1,3-Dimethyl-1h-pyrazolo[3,4-b]pyridine-5-sulfonyl chloride, 95%, 1,3-Dimethyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonyl chloride, 97%, 1,3-Dimethyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g, 50mg.
1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride (CAS 1235439-97-0) is a chemical compound with the molecular formula C8H8ClN3O2S and a molecular weight of 245.69 g/mol. IUPAC name: 1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride. InChIKey: MOLOPKIPWIMCPZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2S |
|---|---|
| Molecular weight | 245.69 g/mol |
| IUPAC name | 1,3-dimethylpyrazolo[5,4-b]pyridine-5-sulfonyl chloride |
| InChIKey | MOLOPKIPWIMCPZ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)