cas: 847818-79-5 — see every product listed under this CAS number, including other names
1,3-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97% (CAS 847818-79-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211134-250MG |
| cas | 847818-79-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 810.15 Pln | |
| Fluorochem | 25g | 1736.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 847818-79-5) is a chemical compound with the molecular formula C11H19BN2O2 and a molecular weight of 222.09 g/mol. IUPAC name: 1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: WZHOBXRNVCZJGB-UHFFFAOYSA-N.
| Molecular formula | C11H19BN2O2 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | WZHOBXRNVCZJGB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN2C)C |
Computed by PubChem (NCBI)