CAS 857530-80-4 appears in our catalog under these names: 3,5-DIMETHYLPYRAZOLE-4-BORONIC ACID PINA, 3,5–Dimethylpyrazole–4–boronic acid, pinacol ester, 3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 97%, 3,5-Dimethylpyrazole-4-boronic Acid Pinacol Ester, 98%, 98%, 3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%. Offered by: Sigma-Aldrich, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5G, 100g, 25g, 1g, 10g, 500g, 250mg, 50g.
3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CAS 857530-80-4) is a chemical compound with the molecular formula C11H19BN2O2 and a molecular weight of 222.09 g/mol. IUPAC name: 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole. InChIKey: GNUDAJTUCJEBEI-UHFFFAOYSA-N.
| Molecular formula | C11H19BN2O2 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| InChIKey | GNUDAJTUCJEBEI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(NN=C2C)C |
Computed by PubChem (NCBI)