cas: 50622-09-8 — see every product listed under this CAS number, including other names
1,3-Dioxolane-4,5-dimethanol, 2,2-dimethyl-, (4S,5S)-, 98%, 98% (CAS 50622-09-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BC4-250mg |
| cas | 50622-09-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 904.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (CAS 50622-09-8) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: [(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol. InChIKey: INVRLGIKFANLFP-WDSKDSINSA-N.
| Molecular formula | C7H14O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | [(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | INVRLGIKFANLFP-WDSKDSINSA-N |
| SMILES | CC1(O[C@H]([C@@H](O1)CO)CO)C |
Computed by PubChem (NCBI)