cas: 1218764-11-4 — see every product listed under this CAS number, including other names
1,3-Pyrrolidinedicarboxylic acid, 4-(4-fluorophenyl)-, 1-(1,1-dimethylethyl) ester, (3R,4S)-rel-, 97% (CAS 1218764-11-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A532396-10g |
| cas | 1218764-11-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 11866.12 Pln | |
| AmBeed | 100mg | 786.10 Pln | |
| AmBeed | 5g | 7146.37 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3R,4S)-4-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1218764-11-4) is a chemical compound with the molecular formula C16H20FNO4 and a molecular weight of 309.33 g/mol. IUPAC name: (3R,4S)-4-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: VRCJPGMBINFMCH-OLZOCXBDSA-N.
| Molecular formula | C16H20FNO4 |
|---|---|
| Molecular weight | 309.33 g/mol |
| IUPAC name | (3R,4S)-4-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | VRCJPGMBINFMCH-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)