cas: 1218764-11-4 — see every product listed under this CAS number, including other names
trans-1-(tert-butoxycarbonyl)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid, 95%+, 95%+ (CAS 1218764-11-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11277R-50mg |
| cas | 1218764-11-4 |
| size | 50mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 237.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
(3R,4S)-4-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1218764-11-4) is a chemical compound with the molecular formula C16H20FNO4 and a molecular weight of 309.33 g/mol. IUPAC name: (3R,4S)-4-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: VRCJPGMBINFMCH-OLZOCXBDSA-N.
| Molecular formula | C16H20FNO4 |
|---|---|
| Molecular weight | 309.33 g/mol |
| IUPAC name | (3R,4S)-4-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | VRCJPGMBINFMCH-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)